C23H31N — CID 123346363
4-[3-(2-but-2-enylidenecycloheptyl)prop-1-en-2-yl]-2-prop-1-en-2-yl-3H-azepine (PubChem CID 123346363) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 4-[3-(2-but-2-enylidenecycloheptyl)prop-1-en-2-yl]-2-prop-1-en-2-yl-3H-azepine.
| Compound Name | 4-[3-(2-but-2-enylidenecycloheptyl)prop-1-en-2-yl]-2-prop-1-en-2-yl-3H-azepine |
|---|---|
| PubChem CID | 123346363 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 4-[3-(2-but-2-enylidenecycloheptyl)prop-1-en-2-yl]-2-prop-1-en-2-yl-3H-azepine |
| SMILES | C=C(C)C1=NC=CC=C(C(=C)CC2CCCCCC2=CC=CC)C1 |
| InChI | InChI=1S/C23H31N/c1-5-6-11-20-12-8-7-9-13-22(20)16-19(4)21-14-10-15-24-23(17-21)18(2)3/h5-6,10-11,14-15,22H,2,4,7-9,12-13,16-17H2,1,3H3 |
| InChIKey | YVVLVYGZLWKOOD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |