C16H22BN — CID 123698691
CID 123698691 (PubChem CID 123698691) has the molecular formula C16H22BN and a molecular weight of 239.17 g/mol.
| Compound Name | CID 123698691 |
|---|---|
| PubChem CID | 123698691 |
| Molecular Formula | C16H22BN |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | — |
| SMILES | [B]C1=C(C(C)C)C=CC(CC2=CN=C(C)CC2)C1 |
| InChI | InChI=1S/C16H22BN/c1-11(2)15-7-6-13(9-16(15)17)8-14-5-4-12(3)18-10-14/h6-7,10-11,13H,4-5,8-9H2,1-3H3 |
| InChIKey | XKSDZYKNYKWJLB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|