C21H25N — CID 123627613
N-(2-methylbutyl)-6-(6-methylidenecyclohepta-1,3,4-trien-1-yl)bicyclo[5.1.0]octa-1(8),5-dien-3-imine (PubChem CID 123627613) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(2-methylbutyl)-6-(6-methylidenecyclohepta-1,3,4-trien-1-yl)bicyclo[5.1.0]octa-1(8),5-dien-3-imine.
| Compound Name | N-(2-methylbutyl)-6-(6-methylidenecyclohepta-1,3,4-trien-1-yl)bicyclo[5.1.0]octa-1(8),5-dien-3-imine |
|---|---|
| PubChem CID | 123627613 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-(2-methylbutyl)-6-(6-methylidenecyclohepta-1,3,4-trien-1-yl)bicyclo[5.1.0]octa-1(8),5-dien-3-imine |
| SMILES | C=C1C=C=CC=C(C2=CC/C(=N/CC(C)CC)CC3=CC32)C1 |
| InChI | InChI=1S/C21H25N/c1-4-15(2)14-22-19-9-10-20(21-13-18(21)12-19)17-8-6-5-7-16(3)11-17/h6-8,10,13,15,21H,3-4,9,11-12,14H2,1-2H3/b22-19- |
| InChIKey | UPUXZIJTFYLDTB-QOCHGBHMSA-N |
| XLogP | 5.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|