C26H37N3OS — CID 123860131
N,N-dimethyl-1-[3-[[4-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazin-6-yl]oxy]propyl]piperidin-4-amine (PubChem CID 123860131) has the molecular formula C26H37N3OS and a molecular weight of 439.67 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-[[4-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazin-6-yl]oxy]propyl]piperidin-4-amine.
| Compound Name | N,N-dimethyl-1-[3-[[4-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazin-6-yl]oxy]propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 123860131 |
| Molecular Formula | C26H37N3OS |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N,N-dimethyl-1-[3-[[4-(2-phenylethyl)-2,3-dihydro-1,4-benzothiazin-6-yl]oxy]propyl]piperidin-4-amine |
| SMILES | CN(C)C1CCN(CCCOc2ccc3c(c2)N(CCc2ccccc2)CCS3)CC1 |
| InChI | InChI=1S/C26H37N3OS/c1-27(2)23-12-15-28(16-13-23)14-6-19-30-24-9-10-26-25(21-24)29(18-20-31-26)17-11-22-7-4-3-5-8-22/h3-5,7-10,21,23H,6,11-20H2,1-2H3 |
| InChIKey | GEVOCWWLJQPQOJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|