C24H33N3O3S2 — CID 71576848
6-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 71576848) has the molecular formula C24H33N3O3S2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 6-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 6-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 71576848 |
| Molecular Formula | C24H33N3O3S2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 6-[3-(4-methyl-1,4-diazepan-1-yl)propoxy]-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCSc3ccc(OCCCN4CCCN(C)CC4)cc32)cc1 |
| InChI | InChI=1S/C24H33N3O3S2/c1-20-5-8-22(9-6-20)32(28,29)27-16-18-31-24-10-7-21(19-23(24)27)30-17-4-13-26-12-3-11-25(2)14-15-26/h5-10,19H,3-4,11-18H2,1-2H3 |
| InChIKey | QWKKZRWAJOTNMX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|