C24H32N4O4S3 — CID 123588366
4-ethenylsulfonyl-N-[3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propyl]-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 123588366) has the molecular formula C24H32N4O4S3 and a molecular weight of 536.75 g/mol. Its IUPAC name is 4-ethenylsulfonyl-N-[3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propyl]-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-ethenylsulfonyl-N-[3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 123588366 |
| Molecular Formula | C24H32N4O4S3 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 4-ethenylsulfonyl-N-[3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | C=CS(=O)(=O)N1CCSc2ccc(NCCCN3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)cc21 |
| InChI | InChI=1S/C24H32N4O4S3/c1-3-34(29,30)28-17-18-33-24-10-7-21(19-23(24)28)25-11-4-12-26-13-15-27(16-14-26)35(31,32)22-8-5-20(2)6-9-22/h3,5-10,19,25H,1,4,11-18H2,2H3 |
| InChIKey | LJTZDJGSLOSDSD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|