C25H26N2O4S3 — CID 71577941
4-[3-[(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-yl)oxy]propyl]morpholine-3-thione (PubChem CID 71577941) has the molecular formula C25H26N2O4S3 and a molecular weight of 514.69 g/mol. Its IUPAC name is 4-[3-[(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-yl)oxy]propyl]morpholine-3-thione.
| Compound Name | 4-[3-[(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-yl)oxy]propyl]morpholine-3-thione |
|---|---|
| PubChem CID | 71577941 |
| Molecular Formula | C25H26N2O4S3 |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 4-[3-[(4-naphthalen-2-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-yl)oxy]propyl]morpholine-3-thione |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCSc2ccc(OCCCN3CCOCC3=S)cc21 |
| InChI | InChI=1S/C25H26N2O4S3/c28-34(29,22-8-6-19-4-1-2-5-20(19)16-22)27-12-15-33-24-9-7-21(17-23(24)27)31-13-3-10-26-11-14-30-18-25(26)32/h1-2,4-9,16-17H,3,10-15,18H2 |
| InChIKey | ODDAJNOEWONQEF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|