C22H30N2O3S2 — CID 24947409
6-(4-methylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 24947409) has the molecular formula C22H30N2O3S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine.
| Compound Name | 6-(4-methylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 24947409 |
| Molecular Formula | C22H30N2O3S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc(OCCCN4CCCCC4)sc3C2)cc1 |
| InChI | InChI=1S/C22H30N2O3S2/c1-18-6-8-20(9-7-18)29(25,26)24-14-10-19-16-22(28-21(19)17-24)27-15-5-13-23-11-3-2-4-12-23/h6-9,16H,2-5,10-15,17H2,1H3 |
| InChIKey | WGJYBHIFTUZASA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|