C18H29N3O2S — CID 24962371
N-propan-2-yl-2-(3-pyrrolidin-1-ylpropoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 24962371) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-propan-2-yl-2-(3-pyrrolidin-1-ylpropoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | N-propan-2-yl-2-(3-pyrrolidin-1-ylpropoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 24962371 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-propan-2-yl-2-(3-pyrrolidin-1-ylpropoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | CC(C)NC(=O)N1CCc2sc(OCCCN3CCCC3)cc2C1 |
| InChI | InChI=1S/C18H29N3O2S/c1-14(2)19-18(22)21-10-6-16-15(13-21)12-17(24-16)23-11-5-9-20-7-3-4-8-20/h12,14H,3-11,13H2,1-2H3,(H,19,22) |
| InChIKey | UQKZCFCHUPTDFT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|