C20H32N2O2S — CID 87455027
3,3-dimethyl-4-[2-(3-pyrrolidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]butanal (PubChem CID 87455027) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 3,3-dimethyl-4-[2-(3-pyrrolidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]butanal.
| Compound Name | 3,3-dimethyl-4-[2-(3-pyrrolidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]butanal |
|---|---|
| PubChem CID | 87455027 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3,3-dimethyl-4-[2-(3-pyrrolidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]butanal |
| SMILES | CC(C)(CC=O)CN1CCc2cc(OCCCN3CCCC3)sc2C1 |
| InChI | InChI=1S/C20H32N2O2S/c1-20(2,7-12-23)16-22-11-6-17-14-19(25-18(17)15-22)24-13-5-10-21-8-3-4-9-21/h12,14H,3-11,13,15-16H2,1-2H3 |
| InChIKey | QDNVNXWFJKRZDT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|