C23H32N2O3S2 — CID 24947596
6-(4-ethylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 24947596) has the molecular formula C23H32N2O3S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is 6-(4-ethylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine.
| Compound Name | 6-(4-ethylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 24947596 |
| Molecular Formula | C23H32N2O3S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 6-(4-ethylphenyl)sulfonyl-2-(3-piperidin-1-ylpropoxy)-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCc3cc(OCCCN4CCCCC4)sc3C2)cc1 |
| InChI | InChI=1S/C23H32N2O3S2/c1-2-19-7-9-21(10-8-19)30(26,27)25-15-11-20-17-23(29-22(20)18-25)28-16-6-14-24-12-4-3-5-13-24/h7-10,17H,2-6,11-16,18H2,1H3 |
| InChIKey | QKQILWDVOVZFCK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|