C26H30N2O4S — CID 18326648
6-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfonyl-5,7-dihydro-4H-furo[2,3-c]pyridine (PubChem CID 18326648) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is 6-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfonyl-5,7-dihydro-4H-furo[2,3-c]pyridine.
| Compound Name | 6-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfonyl-5,7-dihydro-4H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 18326648 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 6-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfonyl-5,7-dihydro-4H-furo[2,3-c]pyridine |
| SMILES | O=S(=O)(c1ccc(-c2ccc(OCCCN3CCCC3)cc2)cc1)N1CCc2ccoc2C1 |
| InChI | InChI=1S/C26H30N2O4S/c29-33(30,28-17-12-23-13-19-32-26(23)20-28)25-10-6-22(7-11-25)21-4-8-24(9-5-21)31-18-3-16-27-14-1-2-15-27/h4-11,13,19H,1-3,12,14-18,20H2 |
| InChIKey | CMBHBSWXJGUWED-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|