C35H44 — CID 123860466
1-methyl-4-[3,3,6-trimethyl-2-[[4-[2-(4-prop-1-enylphenyl)ethenyl]phenyl]methyl]heptyl]benzene (PubChem CID 123860466) has the molecular formula C35H44 and a molecular weight of 464.74 g/mol. Its IUPAC name is 1-methyl-4-[3,3,6-trimethyl-2-[[4-[2-(4-prop-1-enylphenyl)ethenyl]phenyl]methyl]heptyl]benzene.
| Compound Name | 1-methyl-4-[3,3,6-trimethyl-2-[[4-[2-(4-prop-1-enylphenyl)ethenyl]phenyl]methyl]heptyl]benzene |
|---|---|
| PubChem CID | 123860466 |
| Molecular Formula | C35H44 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | 1-methyl-4-[3,3,6-trimethyl-2-[[4-[2-(4-prop-1-enylphenyl)ethenyl]phenyl]methyl]heptyl]benzene |
| SMILES | CC=Cc1ccc(C=Cc2ccc(CC(Cc3ccc(C)cc3)C(C)(C)CCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H44/c1-7-8-29-13-15-30(16-14-29)17-18-31-19-21-33(22-20-31)26-34(35(5,6)24-23-27(2)3)25-32-11-9-28(4)10-12-32/h7-22,27,34H,23-26H2,1-6H3 |
| InChIKey | QOIDALXEYAKQJQ-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|