C26H50 — CID 123861740
3-tert-butyl-6-ethyl-5,5,11,11-tetramethyl-6-propyltrideca-1,8-diene (PubChem CID 123861740) has the molecular formula C26H50 and a molecular weight of 362.69 g/mol. Its IUPAC name is 3-tert-butyl-6-ethyl-5,5,11,11-tetramethyl-6-propyltrideca-1,8-diene.
| Compound Name | 3-tert-butyl-6-ethyl-5,5,11,11-tetramethyl-6-propyltrideca-1,8-diene |
|---|---|
| PubChem CID | 123861740 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | 3-tert-butyl-6-ethyl-5,5,11,11-tetramethyl-6-propyltrideca-1,8-diene |
| SMILES | C=CC(CC(C)(C)C(CC)(CC=CCC(C)(C)CC)CCC)C(C)(C)C |
| InChI | InChI=1S/C26H50/c1-12-18-26(15-4,20-17-16-19-24(8,9)14-3)25(10,11)21-22(13-2)23(5,6)7/h13,16-17,22H,2,12,14-15,18-21H2,1,3-11H3 |
| InChIKey | JJSMMPZINZEAFK-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|