C19H21F2N3OS — CID 123862073
N-(3,5-difluorophenyl)-3-piperazin-1-yl-5-(1-sulfanylethyl)benzamide (PubChem CID 123862073) has the molecular formula C19H21F2N3OS and a molecular weight of 377.46 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-piperazin-1-yl-5-(1-sulfanylethyl)benzamide.
| Compound Name | N-(3,5-difluorophenyl)-3-piperazin-1-yl-5-(1-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 123862073 |
| Molecular Formula | C19H21F2N3OS |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-piperazin-1-yl-5-(1-sulfanylethyl)benzamide |
| SMILES | CC(S)c1cc(C(=O)Nc2cc(F)cc(F)c2)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C19H21F2N3OS/c1-12(26)13-6-14(8-18(7-13)24-4-2-22-3-5-24)19(25)23-17-10-15(20)9-16(21)11-17/h6-12,22,26H,2-5H2,1H3,(H,23,25) |
| InChIKey | XAGDPVLLURZGMH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|