About 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene
3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene (PubChem CID 123863179) has the molecular formula C9H11F3O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene.
Analyze 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene?
The IUPAC name of 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene (CID 123863179) is 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene.
What is the SMILES notation for 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene?
The canonical SMILES for 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene is CC1=CCC(C)C(OC(F)(F)F)=C1.
What is the InChIKey of 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene?
The InChIKey is HIDBCGURHFBWPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O/c1-6-3-4-7(2)8(5-6)13-9(10,11)12/h3,5,7H,4H2,1-2H3.
What are the key properties of 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene?
3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene has a molecular weight of 192.18 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-(trifluoromethoxy)cyclohexa-1,3-diene is sourced from PubChem (CID 123863179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).