C11H14 — CID 139810166
2,4-dimethyl-5,6-dihydro-4H-indene (PubChem CID 139810166) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 2,4-dimethyl-5,6-dihydro-4H-indene.
| Compound Name | 2,4-dimethyl-5,6-dihydro-4H-indene |
|---|---|
| PubChem CID | 139810166 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2,4-dimethyl-5,6-dihydro-4H-indene |
| SMILES | CC1=CC2=CCCC(C)C2=C1 |
| InChI | InChI=1S/C11H14/c1-8-6-10-5-3-4-9(2)11(10)7-8/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | YCJHRFVLDXZXNM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |