C12H18 — CID 171800450
1,5-dimethyl-1,2,3,4,6,7-hexahydronaphthalene (PubChem CID 171800450) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 1,5-dimethyl-1,2,3,4,6,7-hexahydronaphthalene.
| Compound Name | 1,5-dimethyl-1,2,3,4,6,7-hexahydronaphthalene |
|---|---|
| PubChem CID | 171800450 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1,5-dimethyl-1,2,3,4,6,7-hexahydronaphthalene |
| SMILES | CC1=C2CCCC(C)C2=CCC1 |
| InChI | InChI=1S/C12H18/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | QBWAPTDQKQQRSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |