C23H19Cl2F3N4 — CID 123863503
4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N'-(pyrimidin-5-ylmethyl)benzenecarboximidamide (PubChem CID 123863503) has the molecular formula C23H19Cl2F3N4 and a molecular weight of 479.33 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N'-(pyrimidin-5-ylmethyl)benzenecarboximidamide.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N'-(pyrimidin-5-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 123863503 |
| Molecular Formula | C23H19Cl2F3N4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N'-(pyrimidin-5-ylmethyl)benzenecarboximidamide |
| SMILES | Cc1cc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1/C(N)=N/Cc1cncnc1 |
| InChI | InChI=1S/C23H19Cl2F3N4/c1-14-6-15(2-4-20(14)22(29)32-12-16-10-30-13-31-11-16)3-5-21(23(26,27)28)17-7-18(24)9-19(25)8-17/h2-11,13,21H,12H2,1H3,(H2,29,32) |
| InChIKey | ANYICYFXVUUTBJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|