C23H17Cl2F3N3O- — CID 144653074
4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-(pyrimidin-5-ylmethyl)benzenecarboximidate (PubChem CID 144653074) has the molecular formula C23H17Cl2F3N3O- and a molecular weight of 479.31 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-(pyrimidin-5-ylmethyl)benzenecarboximidate.
| Compound Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-(pyrimidin-5-ylmethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 144653074 |
| Molecular Formula | C23H17Cl2F3N3O- |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-(pyrimidin-5-ylmethyl)benzenecarboximidate |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1/C([O-])=N/Cc1cncnc1 |
| InChI | InChI=1S/C23H18Cl2F3N3O/c1-14-6-15(2-4-20(14)22(32)31-12-16-10-29-13-30-11-16)3-5-21(23(26,27)28)17-7-18(24)9-19(25)8-17/h2-11,13,21H,12H2,1H3,(H,31,32)/p-1/b5-3+ |
| InChIKey | ZVXIHJZJKVXALN-HWKANZROSA-M |
| XLogP | 5.76 |
| TPSA | 61.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|