C25H42N6O4 — CID 123863724
4-(5-aminopentoxy)-1-N-cyclohexyl-6-[5-(diaminomethylideneamino)pentoxy]benzene-1,3-dicarboxamide (PubChem CID 123863724) has the molecular formula C25H42N6O4 and a molecular weight of 490.65 g/mol. Its IUPAC name is 4-(5-aminopentoxy)-1-N-cyclohexyl-6-[5-(diaminomethylideneamino)pentoxy]benzene-1,3-dicarboxamide.
| Compound Name | 4-(5-aminopentoxy)-1-N-cyclohexyl-6-[5-(diaminomethylideneamino)pentoxy]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 123863724 |
| Molecular Formula | C25H42N6O4 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 4-(5-aminopentoxy)-1-N-cyclohexyl-6-[5-(diaminomethylideneamino)pentoxy]benzene-1,3-dicarboxamide |
| SMILES | NCCCCCOc1cc(OCCCCCN=C(N)N)c(C(=O)NC2CCCCC2)cc1C(N)=O |
| InChI | InChI=1S/C25H42N6O4/c26-12-6-2-8-14-34-21-17-22(35-15-9-3-7-13-30-25(28)29)20(16-19(21)23(27)32)24(33)31-18-10-4-1-5-11-18/h16-18H,1-15,26H2,(H2,27,32)(H,31,33)(H4,28,29,30) |
| InChIKey | RIQCEBWWOSQCMM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 181.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|