C19H27ClN2 — CID 123866438
4-[[4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl]-5-chloro-3-ethenyl-2-methyl-2,3-dihydropyridine (PubChem CID 123866438) has the molecular formula C19H27ClN2 and a molecular weight of 318.89 g/mol. Its IUPAC name is 4-[[4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl]-5-chloro-3-ethenyl-2-methyl-2,3-dihydropyridine.
| Compound Name | 4-[[4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl]-5-chloro-3-ethenyl-2-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123866438 |
| Molecular Formula | C19H27ClN2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4-[[4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl]-5-chloro-3-ethenyl-2-methyl-2,3-dihydropyridine |
| SMILES | C=CCC1(CC=C)CNC(CC2=C(Cl)C=NC(C)C2C=C)C1 |
| InChI | InChI=1S/C19H27ClN2/c1-5-8-19(9-6-2)11-15(22-13-19)10-17-16(7-3)14(4)21-12-18(17)20/h5-7,12,14-16,22H,1-3,8-11,13H2,4H3 |
| InChIKey | KBDJPUIPJQNDEG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|