C22H40N2 — CID 143188374
(E)-4-[(Z)-4-(5-ethylpyrrolidin-3-yl)but-1-enyl]dodec-2-en-1-imine (PubChem CID 143188374) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is (E)-4-[(Z)-4-(5-ethylpyrrolidin-3-yl)but-1-enyl]dodec-2-en-1-imine.
| Compound Name | (E)-4-[(Z)-4-(5-ethylpyrrolidin-3-yl)but-1-enyl]dodec-2-en-1-imine |
|---|---|
| PubChem CID | 143188374 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | (E)-4-[(Z)-4-(5-ethylpyrrolidin-3-yl)but-1-enyl]dodec-2-en-1-imine |
| SMILES | [H]/N=C/C=C/C(/C=C\CCC1CNC(CC)C1)CCCCCCCC |
| InChI | InChI=1S/C22H40N2/c1-3-5-6-7-8-9-13-20(16-12-17-23)14-10-11-15-21-18-22(4-2)24-19-21/h10,12,14,16-17,20-24H,3-9,11,13,15,18-19H2,1-2H3/b14-10-,16-12+,23-17+ |
| InChIKey | KMSHJIDWPHDNKU-GMROPAQCSA-N |
| XLogP | 6.28 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|