C16H15NO3 — CID 123868213
9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraene-7,11-diol (PubChem CID 123868213) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraene-7,11-diol.
| Compound Name | 9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraene-7,11-diol |
|---|---|
| PubChem CID | 123868213 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraene-7,11-diol |
| SMILES | Oc1ccc2c3c1OC1C(O)C=CC4C5NC5(C2)CC341 |
| InChI | InChI=1S/C16H15NO3/c18-9-3-1-7-5-15-6-16-8(13(15)17-15)2-4-10(19)14(16)20-12(9)11(7)16/h1-4,8,10,13-14,17-19H,5-6H2 |
| InChIKey | BIZAXJVPMIGTOO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|