C18H22F2N4O2 — CID 123868700
1-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 123868700) has the molecular formula C18H22F2N4O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | 1-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 123868700 |
| Molecular Formula | C18H22F2N4O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)c1c[nH]c2ncnc(OC3CCC(F)(F)CC3)c12 |
| InChI | InChI=1S/C18H22F2N4O2/c1-24(2)9-3-4-14(25)13-10-21-16-15(13)17(23-11-22-16)26-12-5-7-18(19,20)8-6-12/h3-4,10-12H,5-9H2,1-2H3,(H,21,22,23) |
| InChIKey | PLNAIBXCQFSBLR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|