C23H30F2N6O2 — CID 177243273
(E)-1-[(3aS,6aR)-3a,6a-difluoro-2-[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 177243273) has the molecular formula C23H30F2N6O2 and a molecular weight of 460.53 g/mol. Its IUPAC name is (E)-1-[(3aS,6aR)-3a,6a-difluoro-2-[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-[(3aS,6aR)-3a,6a-difluoro-2-[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 177243273 |
| Molecular Formula | C23H30F2N6O2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (E)-1-[(3aS,6aR)-3a,6a-difluoro-2-[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1C[C@@]2(F)CN(c3ncnc4[nH]cc(C5CCOCC5)c34)C[C@@]2(F)C1 |
| InChI | InChI=1S/C23H30F2N6O2/c1-29(2)7-3-4-18(32)30-11-22(24)13-31(14-23(22,25)12-30)21-19-17(16-5-8-33-9-6-16)10-26-20(19)27-15-28-21/h3-4,10,15-16H,5-9,11-14H2,1-2H3,(H,26,27,28)/b4-3+/t22-,23+ |
| InChIKey | SCIINEJRRLITEF-WYPLOBGCSA-N |
| XLogP | 2.05 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|