C19H24N4O3 — CID 177243139
1-[(3R,4R)-3-methyl-4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 177243139) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[(3R,4R)-3-methyl-4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4R)-3-methyl-4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 177243139 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[(3R,4R)-3-methyl-4-[[5-(oxan-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](C)[C@@H](Oc2ncnc3[nH]cc(C4CCOCC4)c23)C1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-16(24)23-9-12(2)15(10-23)26-19-17-14(13-4-6-25-7-5-13)8-20-18(17)21-11-22-19/h3,8,11-13,15H,1,4-7,9-10H2,2H3,(H,20,21,22)/t12-,15+/m1/s1 |
| InChIKey | HKRSHWVOBLWQLL-DOMZBBRYSA-N |
| XLogP | 2.26 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|