C22H29N3O3 — CID 177243093
1-[(3S,5R)-3-methyl-5-[[3-(2-methyloxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 177243093) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-[(3S,5R)-3-methyl-5-[[3-(2-methyloxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S,5R)-3-methyl-5-[[3-(2-methyloxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 177243093 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-[(3S,5R)-3-methyl-5-[[3-(2-methyloxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](C)C[C@@H](Oc2ccnc3[nH]cc(C4CCOC(C)C4)c23)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-20(26)25-12-14(2)9-17(13-25)28-19-5-7-23-22-21(19)18(11-24-22)16-6-8-27-15(3)10-16/h4-5,7,11,14-17H,1,6,8-10,12-13H2,2-3H3,(H,23,24)/t14-,15?,16?,17+/m0/s1 |
| InChIKey | NJNRWARFXZXTQX-ZGRYLRDCSA-N |
| XLogP | 3.65 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|