C21H26N4O2 — CID 177243071
1-[(3aR,6aS)-2-[3-(oxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one (PubChem CID 177243071) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-[3-(oxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(3aR,6aS)-2-[3-(oxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 177243071 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[(3aR,6aS)-2-[3-(oxan-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H]2CN(c3ccnc4[nH]cc(C5CCOCC5)c34)C[C@@H]2C1 |
| InChI | InChI=1S/C21H26N4O2/c1-2-19(26)25-12-15-10-24(11-16(15)13-25)18-3-6-22-21-20(18)17(9-23-21)14-4-7-27-8-5-14/h2-3,6,9,14-16H,1,4-5,7-8,10-13H2,(H,22,23)/t15-,16+ |
| InChIKey | RQPNFUONYYGBRR-IYBDPMFKSA-N |
| XLogP | 2.54 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|