C14H22O4 — CID 123868706
1,8-diethoxy-2,7-dimethylocta-1,7-dien-4-yne-3,6-diol (PubChem CID 123868706) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,8-diethoxy-2,7-dimethylocta-1,7-dien-4-yne-3,6-diol.
| Compound Name | 1,8-diethoxy-2,7-dimethylocta-1,7-dien-4-yne-3,6-diol |
|---|---|
| PubChem CID | 123868706 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1,8-diethoxy-2,7-dimethylocta-1,7-dien-4-yne-3,6-diol |
| SMILES | CCOC=C(C)C(O)C#CC(O)C(C)=COCC |
| InChI | InChI=1S/C14H22O4/c1-5-17-9-11(3)13(15)7-8-14(16)12(4)10-18-6-2/h9-10,13-16H,5-6H2,1-4H3 |
| InChIKey | ZANQWJPVJIEIHF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|