C10H14O2 — CID 101452650
3-ethenylideneoct-4-yne-2,7-diol (PubChem CID 101452650) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-ethenylideneoct-4-yne-2,7-diol.
| Compound Name | 3-ethenylideneoct-4-yne-2,7-diol |
|---|---|
| PubChem CID | 101452650 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-ethenylideneoct-4-yne-2,7-diol |
| SMILES | C=C=C(C#CCC(C)O)C(C)O |
| InChI | InChI=1S/C10H14O2/c1-4-10(9(3)12)7-5-6-8(2)11/h8-9,11-12H,1,6H2,2-3H3 |
| InChIKey | XMBRJSMUOHNFDQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|