C9H12O — CID 134884706
7-methylocta-5,6-dien-1-yn-4-ol (PubChem CID 134884706) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 7-methylocta-5,6-dien-1-yn-4-ol.
| Compound Name | 7-methylocta-5,6-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 134884706 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 7-methylocta-5,6-dien-1-yn-4-ol |
| SMILES | C#CCC(O)C=C=C(C)C |
| InChI | InChI=1S/C9H12O/c1-4-5-9(10)7-6-8(2)3/h1,7,9-10H,5H2,2-3H3 |
| InChIKey | JGEMTHBJBJAZSH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|