C10H14O — CID 134897926
3,7-dimethylocta-5,6-dien-1-yn-4-ol (PubChem CID 134897926) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,7-dimethylocta-5,6-dien-1-yn-4-ol.
| Compound Name | 3,7-dimethylocta-5,6-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 134897926 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3,7-dimethylocta-5,6-dien-1-yn-4-ol |
| SMILES | C#CC(C)C(O)C=C=C(C)C |
| InChI | InChI=1S/C10H14O/c1-5-9(4)10(11)7-6-8(2)3/h1,7,9-11H,2-4H3 |
| InChIKey | SBLJWTQKXYHGAY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|