C11H16O — CID 134981936
4-ethylnona-4,5-dien-1-yn-3-ol (PubChem CID 134981936) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-ethylnona-4,5-dien-1-yn-3-ol.
| Compound Name | 4-ethylnona-4,5-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 134981936 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 4-ethylnona-4,5-dien-1-yn-3-ol |
| SMILES | C#CC(O)C(=C=CCCC)CC |
| InChI | InChI=1S/C11H16O/c1-4-7-8-9-10(5-2)11(12)6-3/h3,8,11-12H,4-5,7H2,1-2H3 |
| InChIKey | KASFJZPKDUAMRC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|