C13H20O — CID 102295142
(5E)-6,10-dimethylundeca-5,9-dien-1-yn-4-ol (PubChem CID 102295142) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (5E)-6,10-dimethylundeca-5,9-dien-1-yn-4-ol.
| Compound Name | (5E)-6,10-dimethylundeca-5,9-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 102295142 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (5E)-6,10-dimethylundeca-5,9-dien-1-yn-4-ol |
| SMILES | C#CCC(O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H20O/c1-5-7-13(14)10-12(4)9-6-8-11(2)3/h1,8,10,13-14H,6-7,9H2,2-4H3/b12-10+ |
| InChIKey | YDXDSBNMLIPUNZ-ZRDIBKRKSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|