C10H18O — CID 86182344
3-ethylocta-3,4-dien-2-ol (PubChem CID 86182344) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 3-ethylocta-3,4-dien-2-ol.
| Compound Name | 3-ethylocta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 86182344 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 3-ethylocta-3,4-dien-2-ol |
| SMILES | CCCC=C=C(CC)C(C)O |
| InChI | InChI=1S/C10H18O/c1-4-6-7-8-10(5-2)9(3)11/h7,9,11H,4-6H2,1-3H3 |
| InChIKey | VKFNEEBZYMRMPN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |