C8H14O2 — CID 15657492
(5R)-2,4-dimethylhexa-2,3-diene-1,5-diol (PubChem CID 15657492) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (5R)-2,4-dimethylhexa-2,3-diene-1,5-diol.
| Compound Name | (5R)-2,4-dimethylhexa-2,3-diene-1,5-diol |
|---|---|
| PubChem CID | 15657492 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (5R)-2,4-dimethylhexa-2,3-diene-1,5-diol |
| SMILES | CC(=C=C(C)[C@@H](C)O)CO |
| InChI | InChI=1S/C8H14O2/c1-6(5-9)4-7(2)8(3)10/h8-10H,5H2,1-3H3/t4?,8-/m1/s1 |
| InChIKey | DPXAGLHYOLSHNE-YJEMDFIKSA-N |
| XLogP | 0.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |