C27H38N4O2 — CID 123869598
2-[2-amino-5-(5-morpholin-4-yl-3-pyridinyl)phenyl]-N-(4-ethylcyclooctyl)acetamide (PubChem CID 123869598) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-[2-amino-5-(5-morpholin-4-yl-3-pyridinyl)phenyl]-N-(4-ethylcyclooctyl)acetamide.
| Compound Name | 2-[2-amino-5-(5-morpholin-4-yl-3-pyridinyl)phenyl]-N-(4-ethylcyclooctyl)acetamide |
|---|---|
| PubChem CID | 123869598 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 2-[2-amino-5-(5-morpholin-4-yl-3-pyridinyl)phenyl]-N-(4-ethylcyclooctyl)acetamide |
| SMILES | CCC1CCCCC(NC(=O)Cc2cc(-c3cncc(N4CCOCC4)c3)ccc2N)CC1 |
| InChI | InChI=1S/C27H38N4O2/c1-2-20-5-3-4-6-24(9-7-20)30-27(32)17-22-15-21(8-10-26(22)28)23-16-25(19-29-18-23)31-11-13-33-14-12-31/h8,10,15-16,18-20,24H,2-7,9,11-14,17,28H2,1H3,(H,30,32) |
| InChIKey | NEQCLGACTMQQBQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|