C11H20O5Si — CID 123869854
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolane-2,3-dione (PubChem CID 123869854) has the molecular formula C11H20O5Si and a molecular weight of 260.36 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolane-2,3-dione.
| Compound Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolane-2,3-dione |
|---|---|
| PubChem CID | 123869854 |
| Molecular Formula | C11H20O5Si |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolane-2,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1OC(=O)C(=O)C1O |
| InChI | InChI=1S/C11H20O5Si/c1-11(2,3)17(4,5)15-6-7-8(12)9(13)10(14)16-7/h7-8,12H,6H2,1-5H3/t7-,8?/m0/s1 |
| InChIKey | SIVJOAUXLKMICG-JAMMHHFISA-N |
| XLogP | 0.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|