About N-methylbut-2-enimidoyl fluoride
N-methylbut-2-enimidoyl fluoride (PubChem CID 123871369) has the molecular formula C5H8FN
and a molecular weight of 101.12 g/mol. Its IUPAC name is N-methylbut-2-enimidoyl fluoride.
Molecular Properties
| Compound Name | N-methylbut-2-enimidoyl fluoride |
| PubChem CID | 123871369 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | N-methylbut-2-enimidoyl fluoride |
| SMILES | CC=C/C(F)=N/C |
| InChI | InChI=1S/C5H8FN/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3?,7-5- |
| InChIKey | VCFBLZPUEXRJNG-YFPBZNGSSA-N |
| XLogP | 1.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylbut-2-enimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylbut-2-enimidoyl fluoride?
The IUPAC name of N-methylbut-2-enimidoyl fluoride (CID 123871369) is N-methylbut-2-enimidoyl fluoride.
What is the SMILES notation for N-methylbut-2-enimidoyl fluoride?
The canonical SMILES for N-methylbut-2-enimidoyl fluoride is CC=C/C(F)=N/C.
What is the InChIKey of N-methylbut-2-enimidoyl fluoride?
The InChIKey is VCFBLZPUEXRJNG-YFPBZNGSSA-N. The full InChI is InChI=1S/C5H8FN/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3?,7-5-.
What are the key properties of N-methylbut-2-enimidoyl fluoride?
N-methylbut-2-enimidoyl fluoride has a molecular weight of 101.12 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylbut-2-enimidoyl fluoride is sourced from PubChem (CID 123871369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).