(Z)-N-methylbut-2-enimidoyl fluoride

C5H8FN — CID 143694284

IUPAC(Z)-N-methylbut-2-enimidoyl fluoride
SMILESC/C=C\C(F)=N\C
InChIInChI=1S/C5H8FN/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3-,7-5-
InChIKeyVCFBLZPUEXRJNG-MRWCJKGFSA-N
MW101.12 g/mol
LogP1.56
Rot. Bonds1

About (Z)-N-methylbut-2-enimidoyl fluoride

(Z)-N-methylbut-2-enimidoyl fluoride (PubChem CID 143694284) has the molecular formula C5H8FN and a molecular weight of 101.12 g/mol. Its IUPAC name is (Z)-N-methylbut-2-enimidoyl fluoride.

Molecular Properties

Compound Name(Z)-N-methylbut-2-enimidoyl fluoride
PubChem CID143694284
Molecular FormulaC5H8FN
Molecular Weight101.12 g/mol
Exact Mass101.06
IUPAC Name(Z)-N-methylbut-2-enimidoyl fluoride
SMILESC/C=C\C(F)=N\C
InChIInChI=1S/C5H8FN/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3-,7-5-
InChIKeyVCFBLZPUEXRJNG-MRWCJKGFSA-N
XLogP1.56
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500101.12
LogP ≤ 51.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (Z)-N-methylbut-2-enimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-N-methylbut-2-enimidoyl fluoride?
The IUPAC name of (Z)-N-methylbut-2-enimidoyl fluoride (CID 143694284) is (Z)-N-methylbut-2-enimidoyl fluoride.
What is the SMILES notation for (Z)-N-methylbut-2-enimidoyl fluoride?
The canonical SMILES for (Z)-N-methylbut-2-enimidoyl fluoride is C/C=C\C(F)=N\C.
What is the InChIKey of (Z)-N-methylbut-2-enimidoyl fluoride?
The InChIKey is VCFBLZPUEXRJNG-MRWCJKGFSA-N. The full InChI is InChI=1S/C5H8FN/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3-,7-5-.
What are the key properties of (Z)-N-methylbut-2-enimidoyl fluoride?
(Z)-N-methylbut-2-enimidoyl fluoride has a molecular weight of 101.12 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methylbut-2-enimidoyl fluoride is sourced from PubChem (CID 143694284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).