C22H28N6O2 — CID 123871714
N,N-dimethyl-3-[3-[[5-methyl-3-(3-penta-1,3-dien-2-yl-1,2,4-oxadiazol-5-yl)-1,2,4-triazol-1-yl]methyl]phenoxy]propan-1-amine (PubChem CID 123871714) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-[[5-methyl-3-(3-penta-1,3-dien-2-yl-1,2,4-oxadiazol-5-yl)-1,2,4-triazol-1-yl]methyl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[3-[[5-methyl-3-(3-penta-1,3-dien-2-yl-1,2,4-oxadiazol-5-yl)-1,2,4-triazol-1-yl]methyl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 123871714 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N,N-dimethyl-3-[3-[[5-methyl-3-(3-penta-1,3-dien-2-yl-1,2,4-oxadiazol-5-yl)-1,2,4-triazol-1-yl]methyl]phenoxy]propan-1-amine |
| SMILES | C=C(C=CC)c1noc(-c2nc(C)n(Cc3cccc(OCCCN(C)C)c3)n2)n1 |
| InChI | InChI=1S/C22H28N6O2/c1-6-9-16(2)20-24-22(30-26-20)21-23-17(3)28(25-21)15-18-10-7-11-19(14-18)29-13-8-12-27(4)5/h6-7,9-11,14H,2,8,12-13,15H2,1,3-5H3 |
| InChIKey | FQGDYTQBIIQCCS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|