C19H23ClN4O — CID 123872307
N-[3-[[1-[1-[[(E)-4-chloropent-3-en-2-ylidene]amino]ethenylamino]ethylideneamino]methyl]phenyl]prop-2-enamide (PubChem CID 123872307) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[3-[[1-[1-[[(E)-4-chloropent-3-en-2-ylidene]amino]ethenylamino]ethylideneamino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[1-[1-[[(E)-4-chloropent-3-en-2-ylidene]amino]ethenylamino]ethylideneamino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123872307 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[3-[[1-[1-[[(E)-4-chloropent-3-en-2-ylidene]amino]ethenylamino]ethylideneamino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C/N=C(\C)NC(=C)N=C(C)/C=C(\C)Cl)c1 |
| InChI | InChI=1S/C19H23ClN4O/c1-6-19(25)24-18-9-7-8-17(11-18)12-21-15(4)23-16(5)22-14(3)10-13(2)20/h6-11H,1,5,12H2,2-4H3,(H,21,23)(H,24,25)/b13-10+,22-14? |
| InChIKey | OFGMFZQVQUAQDZ-OVSIYQDNSA-N |
| XLogP | 4.39 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|