C21H31N3O — CID 145208036
N-[3-[[2,3-dimethyl-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;propane (PubChem CID 145208036) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[3-[[2,3-dimethyl-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;propane.
| Compound Name | N-[3-[[2,3-dimethyl-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;propane |
|---|---|
| PubChem CID | 145208036 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | N-[3-[[2,3-dimethyl-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;propane |
| SMILES | C=CC(=O)Nc1cccc(/N=C(/NC(=C)C)C(C)=C(C)C)c1.CCC |
| InChI | InChI=1S/C18H23N3O.C3H8/c1-7-17(22)20-15-9-8-10-16(11-15)21-18(19-13(4)5)14(6)12(2)3;1-3-2/h7-11H,1,4H2,2-3,5-6H3,(H,19,21)(H,20,22);3H2,1-2H3 |
| InChIKey | FDVFEZGJMKSVMV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|