C33H47ClN4O3 — CID 144683353
N-[3-[[(E)-2-chloro-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;3-methoxy-4-methyl-N,N-dipropylaniline;propan-2-one (PubChem CID 144683353) has the molecular formula C33H47ClN4O3 and a molecular weight of 583.22 g/mol. Its IUPAC name is N-[3-[[(E)-2-chloro-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;3-methoxy-4-methyl-N,N-dipropylaniline;propan-2-one.
| Compound Name | N-[3-[[(E)-2-chloro-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;3-methoxy-4-methyl-N,N-dipropylaniline;propan-2-one |
|---|---|
| PubChem CID | 144683353 |
| Molecular Formula | C33H47ClN4O3 |
| Molecular Weight | 583.22 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | N-[3-[[(E)-2-chloro-1-(prop-1-en-2-ylamino)but-2-enylidene]amino]phenyl]prop-2-enamide;3-methoxy-4-methyl-N,N-dipropylaniline;propan-2-one |
| SMILES | C=CC(=O)Nc1cccc(/N=C(NC(=C)C)\C(Cl)=C/C)c1.CC(C)=O.CCCN(CCC)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C16H18ClN3O.C14H23NO.C3H6O/c1-5-14(17)16(18-11(3)4)20-13-9-7-8-12(10-13)19-15(21)6-2;1-5-9-15(10-6-2)13-8-7-12(3)14(11-13)16-4;1-3(2)4/h5-10H,2-3H2,1,4H3,(H,18,20)(H,19,21);7-8,11H,5-6,9-10H2,1-4H3;1-2H3/b14-5+;; |
| InChIKey | URKPKHVYQSFPMY-UPWXDAOZSA-N |
| XLogP | 8.33 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.22 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|