C26H31F3N3O4Si+ — CID 123872514
1-[[4-[5-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-2-pyridinyl]phenoxy]methyl]cyclopropane-1-carboxylic acid (PubChem CID 123872514) has the molecular formula C26H31F3N3O4Si+ and a molecular weight of 534.63 g/mol. Its IUPAC name is 1-[[4-[5-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-2-pyridinyl]phenoxy]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[4-[5-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-2-pyridinyl]phenoxy]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 123872514 |
| Molecular Formula | C26H31F3N3O4Si+ |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 1-[[4-[5-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-2-pyridinyl]phenoxy]methyl]cyclopropane-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOC[n+]1cc(C(F)(F)F)[nH]c1-c1ccc(-c2ccc(OCC3(C(=O)O)CC3)cc2)nc1 |
| InChI | InChI=1S/C26H30F3N3O4Si/c1-37(2,3)13-12-35-17-32-15-22(26(27,28)29)31-23(32)19-6-9-21(30-14-19)18-4-7-20(8-5-18)36-16-25(10-11-25)24(33)34/h4-9,14-15H,10-13,16-17H2,1-3H3,(H,33,34)/p+1 |
| InChIKey | ZFZQGVMGDRVZEZ-UHFFFAOYSA-O |
| XLogP | 5.61 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|