C16H20BrF4N2OSi+ — CID 123746915
2-[[2-(4-bromo-2-fluorophenyl)-5-(trifluoromethyl)-1H-imidazol-3-ium-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123746915) has the molecular formula C16H20BrF4N2OSi+ and a molecular weight of 440.33 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-fluorophenyl)-5-(trifluoromethyl)-1H-imidazol-3-ium-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(4-bromo-2-fluorophenyl)-5-(trifluoromethyl)-1H-imidazol-3-ium-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123746915 |
| Molecular Formula | C16H20BrF4N2OSi+ |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-[[2-(4-bromo-2-fluorophenyl)-5-(trifluoromethyl)-1H-imidazol-3-ium-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOC[n+]1cc(C(F)(F)F)[nH]c1-c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H19BrF4N2OSi/c1-25(2,3)7-6-24-10-23-9-14(16(19,20)21)22-15(23)12-5-4-11(17)8-13(12)18/h4-5,8-9H,6-7,10H2,1-3H3/p+1 |
| InChIKey | PGWACNDFERUMLM-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 28.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|