C16H28 — CID 123873270
4,4,8,9,9-pentamethyl-3-methylidenedeca-1,7-diene (PubChem CID 123873270) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 4,4,8,9,9-pentamethyl-3-methylidenedeca-1,7-diene.
| Compound Name | 4,4,8,9,9-pentamethyl-3-methylidenedeca-1,7-diene |
|---|---|
| PubChem CID | 123873270 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 4,4,8,9,9-pentamethyl-3-methylidenedeca-1,7-diene |
| SMILES | C=CC(=C)C(C)(C)CCC=C(C)C(C)(C)C |
| InChI | InChI=1S/C16H28/c1-9-13(2)16(7,8)12-10-11-14(3)15(4,5)6/h9,11H,1-2,10,12H2,3-8H3 |
| InChIKey | AEZACXFXWNIOMK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|