C22H39Br — CID 123925611
1-bromo-9-ethyl-3,4,4,8,9,13-hexamethyltetradeca-2,7,12-triene (PubChem CID 123925611) has the molecular formula C22H39Br and a molecular weight of 383.46 g/mol. Its IUPAC name is 1-bromo-9-ethyl-3,4,4,8,9,13-hexamethyltetradeca-2,7,12-triene.
| Compound Name | 1-bromo-9-ethyl-3,4,4,8,9,13-hexamethyltetradeca-2,7,12-triene |
|---|---|
| PubChem CID | 123925611 |
| Molecular Formula | C22H39Br |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-bromo-9-ethyl-3,4,4,8,9,13-hexamethyltetradeca-2,7,12-triene |
| SMILES | CCC(C)(CCC=C(C)C)C(C)=CCCC(C)(C)C(C)=CCBr |
| InChI | InChI=1S/C22H39Br/c1-9-22(8,16-10-12-18(2)3)20(5)13-11-15-21(6,7)19(4)14-17-23/h12-14H,9-11,15-17H2,1-8H3 |
| InChIKey | CKCSGCUXQJQRKO-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|