C24H38S — CID 131977515
[(2E,7E)-4-ethyl-3,4,8,9,9-pentamethylundeca-2,7-dienyl]sulfanylbenzene (PubChem CID 131977515) has the molecular formula C24H38S and a molecular weight of 358.64 g/mol. Its IUPAC name is [(2E,7E)-4-ethyl-3,4,8,9,9-pentamethylundeca-2,7-dienyl]sulfanylbenzene.
| Compound Name | [(2E,7E)-4-ethyl-3,4,8,9,9-pentamethylundeca-2,7-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 131977515 |
| Molecular Formula | C24H38S |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | [(2E,7E)-4-ethyl-3,4,8,9,9-pentamethylundeca-2,7-dienyl]sulfanylbenzene |
| SMILES | CCC(C)(C)/C(C)=C/CCC(C)(CC)/C(C)=C/CSc1ccccc1 |
| InChI | InChI=1S/C24H38S/c1-8-23(5,6)20(3)14-13-18-24(7,9-2)21(4)17-19-25-22-15-11-10-12-16-22/h10-12,14-17H,8-9,13,18-19H2,1-7H3/b20-14+,21-17+ |
| InChIKey | NJZCFVXPGPZRMR-PQBPFAQHSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|